C31H36 — CID 142358936
2,3-dimethyl-1-[4-(4-methylphenyl)phenyl]-4-[(E)-4-prop-1-en-2-ylhept-4-en-3-yl]benzene (PubChem CID 142358936) has the molecular formula C31H36 and a molecular weight of 408.63 g/mol. Its IUPAC name is 2,3-dimethyl-1-[4-(4-methylphenyl)phenyl]-4-[(E)-4-prop-1-en-2-ylhept-4-en-3-yl]benzene.
| Compound Name | 2,3-dimethyl-1-[4-(4-methylphenyl)phenyl]-4-[(E)-4-prop-1-en-2-ylhept-4-en-3-yl]benzene |
|---|---|
| PubChem CID | 142358936 |
| Molecular Formula | C31H36 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | 2,3-dimethyl-1-[4-(4-methylphenyl)phenyl]-4-[(E)-4-prop-1-en-2-ylhept-4-en-3-yl]benzene |
| SMILES | C=C(C)/C(=C/CC)C(CC)c1ccc(-c2ccc(-c3ccc(C)cc3)cc2)c(C)c1C |
| InChI | InChI=1S/C31H36/c1-8-10-29(21(3)4)28(9-2)31-20-19-30(23(6)24(31)7)27-17-15-26(16-18-27)25-13-11-22(5)12-14-25/h10-20,28H,3,8-9H2,1-2,4-7H3/b29-10- |
| InChIKey | KLORSXFEADNMJS-DANHRZQXSA-N |
| XLogP | 9.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|