C23H28N6O6S — CID 142359489
2-[(2S,4R)-2-cyano-2,4-dimethyl-5-oxopyrrolidin-1-yl]-N-[4-(2,6-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]ethanesulfonamide;molecular hydrogen (PubChem CID 142359489) has the molecular formula C23H28N6O6S and a molecular weight of 516.58 g/mol. Its IUPAC name is 2-[(2S,4R)-2-cyano-2,4-dimethyl-5-oxopyrrolidin-1-yl]-N-[4-(2,6-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]ethanesulfonamide;molecular hydrogen.
| Compound Name | 2-[(2S,4R)-2-cyano-2,4-dimethyl-5-oxopyrrolidin-1-yl]-N-[4-(2,6-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]ethanesulfonamide;molecular hydrogen |
|---|---|
| PubChem CID | 142359489 |
| Molecular Formula | C23H28N6O6S |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | 2-[(2S,4R)-2-cyano-2,4-dimethyl-5-oxopyrrolidin-1-yl]-N-[4-(2,6-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]ethanesulfonamide;molecular hydrogen |
| SMILES | COc1cccc(OC)c1-n1c(NS(=O)(=O)CCN2C(=O)[C@H](C)C[C@@]2(C)C#N)nnc1-c1ccco1.[H][H] |
| InChI | InChI=1S/C23H26N6O6S.H2/c1-15-13-23(2,14-24)28(21(15)30)10-12-36(31,32)27-22-26-25-20(18-9-6-11-35-18)29(22)19-16(33-3)7-5-8-17(19)34-4;/h5-9,11,15H,10,12-13H2,1-4H3,(H,26,27);1H/t15-,23+;/m1./s1 |
| InChIKey | GYGKVMJWAUIFFD-WUTOIGTNSA-N |
| XLogP | 2.68 |
| TPSA | 152.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |