C24H23N7O — CID 142361920
N-[3-[amino-[(Z)-2-amino-2-(3-methylphenyl)ethenyl]amino]phenyl]-6-(1H-pyrazol-5-yl)pyridine-2-carboxamide (PubChem CID 142361920) has the molecular formula C24H23N7O and a molecular weight of 425.50 g/mol. Its IUPAC name is N-[3-[amino-[(Z)-2-amino-2-(3-methylphenyl)ethenyl]amino]phenyl]-6-(1H-pyrazol-5-yl)pyridine-2-carboxamide.
| Compound Name | N-[3-[amino-[(Z)-2-amino-2-(3-methylphenyl)ethenyl]amino]phenyl]-6-(1H-pyrazol-5-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 142361920 |
| Molecular Formula | C24H23N7O |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | N-[3-[amino-[(Z)-2-amino-2-(3-methylphenyl)ethenyl]amino]phenyl]-6-(1H-pyrazol-5-yl)pyridine-2-carboxamide |
| SMILES | Cc1cccc(/C(N)=C/N(N)c2cccc(NC(=O)c3cccc(-c4ccn[nH]4)n3)c2)c1 |
| InChI | InChI=1S/C24H23N7O/c1-16-5-2-6-17(13-16)20(25)15-31(26)19-8-3-7-18(14-19)28-24(32)23-10-4-9-21(29-23)22-11-12-27-30-22/h2-15H,25-26H2,1H3,(H,27,30)(H,28,32)/b20-15- |
| InChIKey | YPYCAQDTIQUWGQ-HKWRFOASSA-N |
| XLogP | 3.67 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|