C21H24FN4O2P — CID 142362099
(Z)-3-(4-fluoro-2-methyl-1,3-benzoxazol-6-yl)-3-[(1-methyl-5-piperazin-1-yl-2H-pyridin-2-yl)phosphanyl]prop-2-enal (PubChem CID 142362099) has the molecular formula C21H24FN4O2P and a molecular weight of 414.42 g/mol. Its IUPAC name is (Z)-3-(4-fluoro-2-methyl-1,3-benzoxazol-6-yl)-3-[(1-methyl-5-piperazin-1-yl-2H-pyridin-2-yl)phosphanyl]prop-2-enal.
| Compound Name | (Z)-3-(4-fluoro-2-methyl-1,3-benzoxazol-6-yl)-3-[(1-methyl-5-piperazin-1-yl-2H-pyridin-2-yl)phosphanyl]prop-2-enal |
|---|---|
| PubChem CID | 142362099 |
| Molecular Formula | C21H24FN4O2P |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | (Z)-3-(4-fluoro-2-methyl-1,3-benzoxazol-6-yl)-3-[(1-methyl-5-piperazin-1-yl-2H-pyridin-2-yl)phosphanyl]prop-2-enal |
| SMILES | Cc1nc2c(F)cc(/C(=C/C=O)PC3C=CC(N4CCNCC4)=CN3C)cc2o1 |
| InChI | InChI=1S/C21H24FN4O2P/c1-14-24-21-17(22)11-15(12-18(21)28-14)19(5-10-27)29-20-4-3-16(13-25(20)2)26-8-6-23-7-9-26/h3-5,10-13,20,23,29H,6-9H2,1-2H3/b19-5- |
| InChIKey | GWLMWKVJGZKYSR-IPKBDRFQSA-N |
| XLogP | 3.07 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|