C22H23N4O2P — CID 142362167
7-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-(2-methyl-1,3-benzoxazol-6-yl)-1,9a-dihydropyrido[1,2-a][1,3]azaphosphinin-4-one (PubChem CID 142362167) has the molecular formula C22H23N4O2P and a molecular weight of 406.43 g/mol. Its IUPAC name is 7-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-(2-methyl-1,3-benzoxazol-6-yl)-1,9a-dihydropyrido[1,2-a][1,3]azaphosphinin-4-one.
| Compound Name | 7-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-(2-methyl-1,3-benzoxazol-6-yl)-1,9a-dihydropyrido[1,2-a][1,3]azaphosphinin-4-one |
|---|---|
| PubChem CID | 142362167 |
| Molecular Formula | C22H23N4O2P |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 7-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-(2-methyl-1,3-benzoxazol-6-yl)-1,9a-dihydropyrido[1,2-a][1,3]azaphosphinin-4-one |
| SMILES | Cc1nc2ccc(C3=CC(=O)N4C=C(N5CC6CNCC6C5)C=CC4P3)cc2o1 |
| InChI | InChI=1S/C22H23N4O2P/c1-13-24-18-4-2-14(6-19(18)28-13)20-7-21(27)26-12-17(3-5-22(26)29-20)25-10-15-8-23-9-16(15)11-25/h2-7,12,15-16,22-23,29H,8-11H2,1H3 |
| InChIKey | LLOLRQFGEJCJCU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|