C18H19FN3OP — CID 144885451
2-(3-fluorophenyl)-7-piperazin-1-yl-1,9a-dihydropyrido[1,2-a][1,3]azaphosphinin-4-one (PubChem CID 144885451) has the molecular formula C18H19FN3OP and a molecular weight of 343.34 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-7-piperazin-1-yl-1,9a-dihydropyrido[1,2-a][1,3]azaphosphinin-4-one.
| Compound Name | 2-(3-fluorophenyl)-7-piperazin-1-yl-1,9a-dihydropyrido[1,2-a][1,3]azaphosphinin-4-one |
|---|---|
| PubChem CID | 144885451 |
| Molecular Formula | C18H19FN3OP |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 2-(3-fluorophenyl)-7-piperazin-1-yl-1,9a-dihydropyrido[1,2-a][1,3]azaphosphinin-4-one |
| SMILES | O=C1C=C(c2cccc(F)c2)PC2C=CC(N3CCNCC3)=CN12 |
| InChI | InChI=1S/C18H19FN3OP/c19-14-3-1-2-13(10-14)16-11-17(23)22-12-15(4-5-18(22)24-16)21-8-6-20-7-9-21/h1-5,10-12,18,20,24H,6-9H2 |
| InChIKey | QBNCGAXVMNQVOK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|