C14H17FN4O2 — CID 142363811
2-amino-2-[[6-(2-fluorophenyl)-3,6-dihydro-2H-1,4-oxazin-5-yl]imino]-N,N-dimethylacetamide (PubChem CID 142363811) has the molecular formula C14H17FN4O2 and a molecular weight of 292.31 g/mol. Its IUPAC name is 2-amino-2-[[6-(2-fluorophenyl)-3,6-dihydro-2H-1,4-oxazin-5-yl]imino]-N,N-dimethylacetamide.
| Compound Name | 2-amino-2-[[6-(2-fluorophenyl)-3,6-dihydro-2H-1,4-oxazin-5-yl]imino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 142363811 |
| Molecular Formula | C14H17FN4O2 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-amino-2-[[6-(2-fluorophenyl)-3,6-dihydro-2H-1,4-oxazin-5-yl]imino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)/C(N)=N/C1=NCCOC1c1ccccc1F |
| InChI | InChI=1S/C14H17FN4O2/c1-19(2)14(20)12(16)18-13-11(21-8-7-17-13)9-5-3-4-6-10(9)15/h3-6,11H,7-8H2,1-2H3,(H2,16,17,18) |
| InChIKey | YSFRFWQVCZFJEB-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|