C14H28N2 — CID 142369069
ethane;N-ethyl-2-methyl-N,N'-bis[(Z)-prop-1-enyl]propanimidamide (PubChem CID 142369069) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is ethane;N-ethyl-2-methyl-N,N'-bis[(Z)-prop-1-enyl]propanimidamide.
| Compound Name | ethane;N-ethyl-2-methyl-N,N'-bis[(Z)-prop-1-enyl]propanimidamide |
|---|---|
| PubChem CID | 142369069 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | ethane;N-ethyl-2-methyl-N,N'-bis[(Z)-prop-1-enyl]propanimidamide |
| SMILES | C/C=C\N=C(/C(C)C)N(/C=C\C)CC.CC |
| InChI | InChI=1S/C12H22N2.C2H6/c1-6-9-13-12(11(4)5)14(8-3)10-7-2;1-2/h6-7,9-11H,8H2,1-5H3;1-2H3/b9-6-,10-7-,13-12+; |
| InChIKey | BLKSWIJPORJXGK-DQMCSPIBSA-N |
| XLogP | 4.46 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|