C19H15BrF5N5O2S — CID 142370721
7-bromo-3-ethylsulfonyl-2-[3-methyl-6-(1,1,2,2,2-pentafluoroethyl)-3,5-dihydroimidazo[4,5-c]pyridazin-2-yl]quinoline (PubChem CID 142370721) has the molecular formula C19H15BrF5N5O2S and a molecular weight of 552.32 g/mol. Its IUPAC name is 7-bromo-3-ethylsulfonyl-2-[3-methyl-6-(1,1,2,2,2-pentafluoroethyl)-3,5-dihydroimidazo[4,5-c]pyridazin-2-yl]quinoline.
| Compound Name | 7-bromo-3-ethylsulfonyl-2-[3-methyl-6-(1,1,2,2,2-pentafluoroethyl)-3,5-dihydroimidazo[4,5-c]pyridazin-2-yl]quinoline |
|---|---|
| PubChem CID | 142370721 |
| Molecular Formula | C19H15BrF5N5O2S |
| Molecular Weight | 552.32 g/mol |
| Exact Mass | 551.00 |
| IUPAC Name | 7-bromo-3-ethylsulfonyl-2-[3-methyl-6-(1,1,2,2,2-pentafluoroethyl)-3,5-dihydroimidazo[4,5-c]pyridazin-2-yl]quinoline |
| SMILES | CCS(=O)(=O)c1cc2ccc(Br)cc2nc1N1N=c2nc(C(F)(F)C(F)(F)F)[nH]c2=CC1C |
| InChI | InChI=1S/C19H15BrF5N5O2S/c1-3-33(31,32)14-7-10-4-5-11(20)8-12(10)26-16(14)30-9(2)6-13-15(29-30)28-17(27-13)18(21,22)19(23,24)25/h4-9H,3H2,1-2H3,(H,27,28,29) |
| InChIKey | QYUXSOZUCGLABV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|