C19H21F5N6O4S2 — CID 156649323
5-ethylsulfonyl-6-[3-methyl-6-(1,1,2,2,2-pentafluoroethyl)-3,5-dihydroimidazo[4,5-c]pyridazin-2-yl]-N-(2-methylsulfanylethoxy)pyridine-3-carboxamide (PubChem CID 156649323) has the molecular formula C19H21F5N6O4S2 and a molecular weight of 556.54 g/mol. Its IUPAC name is 5-ethylsulfonyl-6-[3-methyl-6-(1,1,2,2,2-pentafluoroethyl)-3,5-dihydroimidazo[4,5-c]pyridazin-2-yl]-N-(2-methylsulfanylethoxy)pyridine-3-carboxamide.
| Compound Name | 5-ethylsulfonyl-6-[3-methyl-6-(1,1,2,2,2-pentafluoroethyl)-3,5-dihydroimidazo[4,5-c]pyridazin-2-yl]-N-(2-methylsulfanylethoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 156649323 |
| Molecular Formula | C19H21F5N6O4S2 |
| Molecular Weight | 556.54 g/mol |
| Exact Mass | 556.10 |
| IUPAC Name | 5-ethylsulfonyl-6-[3-methyl-6-(1,1,2,2,2-pentafluoroethyl)-3,5-dihydroimidazo[4,5-c]pyridazin-2-yl]-N-(2-methylsulfanylethoxy)pyridine-3-carboxamide |
| SMILES | CCS(=O)(=O)c1cc(C(=O)NOCCSC)cnc1N1N=c2nc(C(F)(F)C(F)(F)F)[nH]c2=CC1C |
| InChI | InChI=1S/C19H21F5N6O4S2/c1-4-36(32,33)13-8-11(16(31)29-34-5-6-35-3)9-25-15(13)30-10(2)7-12-14(28-30)27-17(26-12)18(20,21)19(22,23)24/h7-10H,4-6H2,1-3H3,(H,29,31)(H,26,27,28) |
| InChIKey | NBKMVNOPVJVYDQ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.54 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|