C20H19F3N4O — CID 142372176
N-[(Z)-1-amino-3-(2,4-difluoroanilino)but-2-enylidene]-1-(3-fluoro-2-pyridinyl)-2-methylcyclopropane-1-carboxamide (PubChem CID 142372176) has the molecular formula C20H19F3N4O and a molecular weight of 388.39 g/mol. Its IUPAC name is N-[(Z)-1-amino-3-(2,4-difluoroanilino)but-2-enylidene]-1-(3-fluoro-2-pyridinyl)-2-methylcyclopropane-1-carboxamide.
| Compound Name | N-[(Z)-1-amino-3-(2,4-difluoroanilino)but-2-enylidene]-1-(3-fluoro-2-pyridinyl)-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 142372176 |
| Molecular Formula | C20H19F3N4O |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | N-[(Z)-1-amino-3-(2,4-difluoroanilino)but-2-enylidene]-1-(3-fluoro-2-pyridinyl)-2-methylcyclopropane-1-carboxamide |
| SMILES | C/C(=C/C(N)=N/C(=O)C1(c2ncccc2F)CC1C)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C20H19F3N4O/c1-11-10-20(11,18-14(22)4-3-7-25-18)19(28)27-17(24)8-12(2)26-16-6-5-13(21)9-15(16)23/h3-9,11,26H,10H2,1-2H3,(H2,24,27,28)/b12-8- |
| InChIKey | DWRGOKUJMRUEET-WQLSENKSSA-N |
| XLogP | 3.68 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|