C11H23NO — CID 142373465
ethane;6-methoxycyclohexa-1,5-dien-1-amine (PubChem CID 142373465) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is ethane;6-methoxycyclohexa-1,5-dien-1-amine.
| Compound Name | ethane;6-methoxycyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 142373465 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | ethane;6-methoxycyclohexa-1,5-dien-1-amine |
| SMILES | CC.CC.COC1=CCCC=C1N |
| InChI | InChI=1S/C7H11NO.2C2H6/c1-9-7-5-3-2-4-6(7)8;2*1-2/h4-5H,2-3,8H2,1H3;2*1-2H3 |
| InChIKey | CZCOFYBYKNITIX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |