C17H19N3O4 — CID 142375549
5'-[(E)-3-(dimethylamino)prop-2-enoyl]-1'-methyl-7'-nitrospiro[cyclobutane-1,3'-indole]-2'-one (PubChem CID 142375549) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is 5'-[(E)-3-(dimethylamino)prop-2-enoyl]-1'-methyl-7'-nitrospiro[cyclobutane-1,3'-indole]-2'-one.
| Compound Name | 5'-[(E)-3-(dimethylamino)prop-2-enoyl]-1'-methyl-7'-nitrospiro[cyclobutane-1,3'-indole]-2'-one |
|---|---|
| PubChem CID | 142375549 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 5'-[(E)-3-(dimethylamino)prop-2-enoyl]-1'-methyl-7'-nitrospiro[cyclobutane-1,3'-indole]-2'-one |
| SMILES | CN(C)/C=C/C(=O)c1cc([N+](=O)[O-])c2c(c1)C1(CCC1)C(=O)N2C |
| InChI | InChI=1S/C17H19N3O4/c1-18(2)8-5-14(21)11-9-12-15(13(10-11)20(23)24)19(3)16(22)17(12)6-4-7-17/h5,8-10H,4,6-7H2,1-3H3/b8-5+ |
| InChIKey | KDPMVVZXJGLAKZ-VMPITWQZSA-N |
| XLogP | 2.25 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|