C14H15BrN2O3 — CID 177197193
5'-bromo-1'-methyl-7'-nitrospiro[cyclohexane-1,3'-indole]-2'-one (PubChem CID 177197193) has the molecular formula C14H15BrN2O3 and a molecular weight of 339.19 g/mol. Its IUPAC name is 5'-bromo-1'-methyl-7'-nitrospiro[cyclohexane-1,3'-indole]-2'-one.
| Compound Name | 5'-bromo-1'-methyl-7'-nitrospiro[cyclohexane-1,3'-indole]-2'-one |
|---|---|
| PubChem CID | 177197193 |
| Molecular Formula | C14H15BrN2O3 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 5'-bromo-1'-methyl-7'-nitrospiro[cyclohexane-1,3'-indole]-2'-one |
| SMILES | CN1C(=O)C2(CCCCC2)c2cc(Br)cc([N+](=O)[O-])c21 |
| InChI | InChI=1S/C14H15BrN2O3/c1-16-12-10(7-9(15)8-11(12)17(19)20)14(13(16)18)5-3-2-4-6-14/h7-8H,2-6H2,1H3 |
| InChIKey | PHRZBCGHWRZJKV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|