C22H42O — CID 142377230
3,5-dimethyl-8-propyltricyclo[5.2.1.02,6]decane;ethoxyethane;prop-1-ene (PubChem CID 142377230) has the molecular formula C22H42O and a molecular weight of 322.58 g/mol. Its IUPAC name is 3,5-dimethyl-8-propyltricyclo[5.2.1.02,6]decane;ethoxyethane;prop-1-ene.
| Compound Name | 3,5-dimethyl-8-propyltricyclo[5.2.1.02,6]decane;ethoxyethane;prop-1-ene |
|---|---|
| PubChem CID | 142377230 |
| Molecular Formula | C22H42O |
| Molecular Weight | 322.58 g/mol |
| Exact Mass | 322.32 |
| IUPAC Name | 3,5-dimethyl-8-propyltricyclo[5.2.1.02,6]decane;ethoxyethane;prop-1-ene |
| SMILES | C=CC.CCCC1CC2CC1C1C(C)CC(C)C21.CCOCC |
| InChI | InChI=1S/C15H26.C4H10O.C3H6/c1-4-5-11-7-12-8-13(11)15-10(3)6-9(2)14(12)15;1-3-5-4-2;1-3-2/h9-15H,4-8H2,1-3H3;3-4H2,1-2H3;3H,1H2,2H3 |
| InChIKey | VFYODDIBVFBTCN-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.58 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|