C10H24N5+ — CID 142380027
2-[[(E)-4-[2-(2-aminoethylimino)ethylamino]but-3-en-2-yl]amino]ethylazanium (PubChem CID 142380027) has the molecular formula C10H24N5+ and a molecular weight of 214.34 g/mol. Its IUPAC name is 2-[[(E)-4-[2-(2-aminoethylimino)ethylamino]but-3-en-2-yl]amino]ethylazanium.
| Compound Name | 2-[[(E)-4-[2-(2-aminoethylimino)ethylamino]but-3-en-2-yl]amino]ethylazanium |
|---|---|
| PubChem CID | 142380027 |
| Molecular Formula | C10H24N5+ |
| Molecular Weight | 214.34 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 2-[[(E)-4-[2-(2-aminoethylimino)ethylamino]but-3-en-2-yl]amino]ethylazanium |
| SMILES | CC(/C=C/NC/C=N/CCN)NCC[NH3+] |
| InChI | InChI=1S/C10H23N5/c1-10(15-7-4-12)2-5-13-8-9-14-6-3-11/h2,5,9-10,13,15H,3-4,6-8,11-12H2,1H3/p+1/b5-2+,14-9+ |
| InChIKey | VSSDUJQDXTUJMP-FTCPZNPOSA-O |
| XLogP | -1.66 |
| TPSA | 90.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.34 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|