C14H15ClO5S — CID 142380257
2-(oxan-4-yl)-4-oxo-2,3-dihydrochromene-6-sulfonyl chloride (PubChem CID 142380257) has the molecular formula C14H15ClO5S and a molecular weight of 330.79 g/mol. Its IUPAC name is 2-(oxan-4-yl)-4-oxo-2,3-dihydrochromene-6-sulfonyl chloride.
| Compound Name | 2-(oxan-4-yl)-4-oxo-2,3-dihydrochromene-6-sulfonyl chloride |
|---|---|
| PubChem CID | 142380257 |
| Molecular Formula | C14H15ClO5S |
| Molecular Weight | 330.79 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 2-(oxan-4-yl)-4-oxo-2,3-dihydrochromene-6-sulfonyl chloride |
| SMILES | O=C1CC(C2CCOCC2)Oc2ccc(S(=O)(=O)Cl)cc21 |
| InChI | InChI=1S/C14H15ClO5S/c15-21(17,18)10-1-2-13-11(7-10)12(16)8-14(20-13)9-3-5-19-6-4-9/h1-2,7,9,14H,3-6,8H2 |
| InChIKey | ZXKXWNXXAFZHEB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.79 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |