C24H27F2NO3S — CID 142380319
6-[2,4-difluoro-N-(2-methylpropyl)anilino]sulfanyl-2-(oxan-4-yl)-2,3-dihydrochromen-4-one (PubChem CID 142380319) has the molecular formula C24H27F2NO3S and a molecular weight of 447.55 g/mol. Its IUPAC name is 6-[2,4-difluoro-N-(2-methylpropyl)anilino]sulfanyl-2-(oxan-4-yl)-2,3-dihydrochromen-4-one.
| Compound Name | 6-[2,4-difluoro-N-(2-methylpropyl)anilino]sulfanyl-2-(oxan-4-yl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 142380319 |
| Molecular Formula | C24H27F2NO3S |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 6-[2,4-difluoro-N-(2-methylpropyl)anilino]sulfanyl-2-(oxan-4-yl)-2,3-dihydrochromen-4-one |
| SMILES | CC(C)CN(Sc1ccc2c(c1)C(=O)CC(C1CCOCC1)O2)c1ccc(F)cc1F |
| InChI | InChI=1S/C24H27F2NO3S/c1-15(2)14-27(21-5-3-17(25)11-20(21)26)31-18-4-6-23-19(12-18)22(28)13-24(30-23)16-7-9-29-10-8-16/h3-6,11-12,15-16,24H,7-10,13-14H2,1-2H3 |
| InChIKey | GXYADMYALWRGSU-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|