C20H26FN5O2S — CID 142381618
ethane;3-(6-fluoro-1,2-benzoxazol-3-yl)-N-(6-methoxy-3-pyridinyl)azetidine-1-carbothioamide;methanamine (PubChem CID 142381618) has the molecular formula C20H26FN5O2S and a molecular weight of 419.53 g/mol. Its IUPAC name is ethane;3-(6-fluoro-1,2-benzoxazol-3-yl)-N-(6-methoxy-3-pyridinyl)azetidine-1-carbothioamide;methanamine.
| Compound Name | ethane;3-(6-fluoro-1,2-benzoxazol-3-yl)-N-(6-methoxy-3-pyridinyl)azetidine-1-carbothioamide;methanamine |
|---|---|
| PubChem CID | 142381618 |
| Molecular Formula | C20H26FN5O2S |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | ethane;3-(6-fluoro-1,2-benzoxazol-3-yl)-N-(6-methoxy-3-pyridinyl)azetidine-1-carbothioamide;methanamine |
| SMILES | CC.CN.COc1ccc(NC(=S)N2CC(c3noc4cc(F)ccc34)C2)cn1 |
| InChI | InChI=1S/C17H15FN4O2S.C2H6.CH5N/c1-23-15-5-3-12(7-19-15)20-17(25)22-8-10(9-22)16-13-4-2-11(18)6-14(13)24-21-16;2*1-2/h2-7,10H,8-9H2,1H3,(H,20,25);1-2H3;2H2,1H3 |
| InChIKey | OPONUDVQPJXSQG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 89.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|