C24H23FN2O5 — CID 19886394
[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-(3,4,5-trimethoxy-7-bicyclo[4.2.0]octa-1,3,5,7-tetraenyl)methanone (PubChem CID 19886394) has the molecular formula C24H23FN2O5 and a molecular weight of 438.46 g/mol. Its IUPAC name is [4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-(3,4,5-trimethoxy-7-bicyclo[4.2.0]octa-1,3,5,7-tetraenyl)methanone.
| Compound Name | [4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-(3,4,5-trimethoxy-7-bicyclo[4.2.0]octa-1,3,5,7-tetraenyl)methanone |
|---|---|
| PubChem CID | 19886394 |
| Molecular Formula | C24H23FN2O5 |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | [4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-(3,4,5-trimethoxy-7-bicyclo[4.2.0]octa-1,3,5,7-tetraenyl)methanone |
| SMILES | COc1cc2c(c(OC)c1OC)C(C(=O)N1CCC(c3noc4cc(F)ccc34)CC1)=C2 |
| InChI | InChI=1S/C24H23FN2O5/c1-29-19-11-14-10-17(20(14)23(31-3)22(19)30-2)24(28)27-8-6-13(7-9-27)21-16-5-4-15(25)12-18(16)32-26-21/h4-5,10-13H,6-9H2,1-3H3 |
| InChIKey | BQBGQCXGTKXHHS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 74.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |