C12H15N3O2S — CID 142382047
2-but-1-en-2-yloxy-3,4-dimethyl-1-(1,2,4-thiadiazol-5-yl)-2H-pyrrol-5-one (PubChem CID 142382047) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is 2-but-1-en-2-yloxy-3,4-dimethyl-1-(1,2,4-thiadiazol-5-yl)-2H-pyrrol-5-one.
| Compound Name | 2-but-1-en-2-yloxy-3,4-dimethyl-1-(1,2,4-thiadiazol-5-yl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 142382047 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 2-but-1-en-2-yloxy-3,4-dimethyl-1-(1,2,4-thiadiazol-5-yl)-2H-pyrrol-5-one |
| SMILES | C=C(CC)OC1C(C)=C(C)C(=O)N1c1ncns1 |
| InChI | InChI=1S/C12H15N3O2S/c1-5-7(2)17-11-9(4)8(3)10(16)15(11)12-13-6-14-18-12/h6,11H,2,5H2,1,3-4H3 |
| InChIKey | FHHJLUSVPPABFB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|