C11H12ClN3O2S — CID 142382049
2-but-1-en-2-yloxy-3-chloro-4-methyl-1-(1,2,4-thiadiazol-5-yl)-2H-pyrrol-5-one (PubChem CID 142382049) has the molecular formula C11H12ClN3O2S and a molecular weight of 285.76 g/mol. Its IUPAC name is 2-but-1-en-2-yloxy-3-chloro-4-methyl-1-(1,2,4-thiadiazol-5-yl)-2H-pyrrol-5-one.
| Compound Name | 2-but-1-en-2-yloxy-3-chloro-4-methyl-1-(1,2,4-thiadiazol-5-yl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 142382049 |
| Molecular Formula | C11H12ClN3O2S |
| Molecular Weight | 285.76 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 2-but-1-en-2-yloxy-3-chloro-4-methyl-1-(1,2,4-thiadiazol-5-yl)-2H-pyrrol-5-one |
| SMILES | C=C(CC)OC1C(Cl)=C(C)C(=O)N1c1ncns1 |
| InChI | InChI=1S/C11H12ClN3O2S/c1-4-6(2)17-10-8(12)7(3)9(16)15(10)11-13-5-14-18-11/h5,10H,2,4H2,1,3H3 |
| InChIKey | YQHBMRPBNJEDAG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.76 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|