C18H34N2O4 — CID 142382442
3-[(2,2-diethyl-4-hex-4-en-3-yloxybutanoyl)amino]-2-(methylamino)propanoic acid (PubChem CID 142382442) has the molecular formula C18H34N2O4 and a molecular weight of 342.48 g/mol. Its IUPAC name is 3-[(2,2-diethyl-4-hex-4-en-3-yloxybutanoyl)amino]-2-(methylamino)propanoic acid.
| Compound Name | 3-[(2,2-diethyl-4-hex-4-en-3-yloxybutanoyl)amino]-2-(methylamino)propanoic acid |
|---|---|
| PubChem CID | 142382442 |
| Molecular Formula | C18H34N2O4 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | 3-[(2,2-diethyl-4-hex-4-en-3-yloxybutanoyl)amino]-2-(methylamino)propanoic acid |
| SMILES | CC=CC(CC)OCCC(CC)(CC)C(=O)NCC(NC)C(=O)O |
| InChI | InChI=1S/C18H34N2O4/c1-6-10-14(7-2)24-12-11-18(8-3,9-4)17(23)20-13-15(19-5)16(21)22/h6,10,14-15,19H,7-9,11-13H2,1-5H3,(H,20,23)(H,21,22) |
| InChIKey | GVROZWHUEYQOJG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|