C15H30N2 — CID 142385944
ethane;(3Z)-4-methylhexa-1,3-diene;1-methylpyrazole (PubChem CID 142385944) has the molecular formula C15H30N2 and a molecular weight of 238.42 g/mol. Its IUPAC name is ethane;(3Z)-4-methylhexa-1,3-diene;1-methylpyrazole.
| Compound Name | ethane;(3Z)-4-methylhexa-1,3-diene;1-methylpyrazole |
|---|---|
| PubChem CID | 142385944 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | ethane;(3Z)-4-methylhexa-1,3-diene;1-methylpyrazole |
| SMILES | C=C/C=C(/C)CC.CC.CC.Cn1cccn1 |
| InChI | InChI=1S/C7H12.C4H6N2.2C2H6/c1-4-6-7(3)5-2;1-6-4-2-3-5-6;2*1-2/h4,6H,1,5H2,2-3H3;2-4H,1H3;2*1-2H3/b7-6-;;; |
| InChIKey | MGFKFTYNAHKJAD-YYFHNNNUSA-N |
| XLogP | 5.00 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|