C7H7NOS — CID 142387876
3-methyl-4,5-dihydrothieno[3,4-c]pyrrol-6-one (PubChem CID 142387876) has the molecular formula C7H7NOS and a molecular weight of 153.21 g/mol. Its IUPAC name is 3-methyl-4,5-dihydrothieno[3,4-c]pyrrol-6-one.
| Compound Name | 3-methyl-4,5-dihydrothieno[3,4-c]pyrrol-6-one |
|---|---|
| PubChem CID | 142387876 |
| Molecular Formula | C7H7NOS |
| Molecular Weight | 153.21 g/mol |
| Exact Mass | 153.02 |
| IUPAC Name | 3-methyl-4,5-dihydrothieno[3,4-c]pyrrol-6-one |
| SMILES | Cc1scc2c1CNC2=O |
| InChI | InChI=1S/C7H7NOS/c1-4-5-2-8-7(9)6(5)3-10-4/h3H,2H2,1H3,(H,8,9) |
| InChIKey | FZNWXKJSUHSZLV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |