C7H7N3O2 — CID 142388325
4-ethenyl-5-(methylideneamino)-1,2-dihydropyridazine-3,6-dione (PubChem CID 142388325) has the molecular formula C7H7N3O2 and a molecular weight of 165.15 g/mol. Its IUPAC name is 4-ethenyl-5-(methylideneamino)-1,2-dihydropyridazine-3,6-dione.
| Compound Name | 4-ethenyl-5-(methylideneamino)-1,2-dihydropyridazine-3,6-dione |
|---|---|
| PubChem CID | 142388325 |
| Molecular Formula | C7H7N3O2 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | 4-ethenyl-5-(methylideneamino)-1,2-dihydropyridazine-3,6-dione |
| SMILES | C=Cc1c(N=C)c(=O)[nH][nH]c1=O |
| InChI | InChI=1S/C7H7N3O2/c1-3-4-5(8-2)7(12)10-9-6(4)11/h3H,1-2H2,(H,9,11)(H,10,12) |
| InChIKey | NMQUAMYGUJYSLM-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|