C14H21N3O3 — CID 142390396
(Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethenyliminopent-3-enamide;ethane (PubChem CID 142390396) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is (Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethenyliminopent-3-enamide;ethane.
| Compound Name | (Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethenyliminopent-3-enamide;ethane |
|---|---|
| PubChem CID | 142390396 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | (Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethenyliminopent-3-enamide;ethane |
| SMILES | C=C/N=C(\C=C/C)C(=O)NC1CCC(=O)NC1=O.CC |
| InChI | InChI=1S/C12H15N3O3.C2H6/c1-3-5-8(13-4-2)11(17)14-9-6-7-10(16)15-12(9)18;1-2/h3-5,9H,2,6-7H2,1H3,(H,14,17)(H,15,16,18);1-2H3/b5-3-,13-8+; |
| InChIKey | POQOCJOWPFLQBZ-YSAJSQATSA-N |
| XLogP | 1.09 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|