C15H31N5O2 — CID 145488365
(Z)-4-amino-N-(1,5-diamino-1-oxopentan-2-yl)-2-ethyliminopent-3-enamide;propane (PubChem CID 145488365) has the molecular formula C15H31N5O2 and a molecular weight of 313.45 g/mol. Its IUPAC name is (Z)-4-amino-N-(1,5-diamino-1-oxopentan-2-yl)-2-ethyliminopent-3-enamide;propane.
| Compound Name | (Z)-4-amino-N-(1,5-diamino-1-oxopentan-2-yl)-2-ethyliminopent-3-enamide;propane |
|---|---|
| PubChem CID | 145488365 |
| Molecular Formula | C15H31N5O2 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.25 |
| IUPAC Name | (Z)-4-amino-N-(1,5-diamino-1-oxopentan-2-yl)-2-ethyliminopent-3-enamide;propane |
| SMILES | CC/N=C(/C=C(/C)N)C(=O)NC(CCCN)C(N)=O.CCC |
| InChI | InChI=1S/C12H23N5O2.C3H8/c1-3-16-10(7-8(2)14)12(19)17-9(11(15)18)5-4-6-13;1-3-2/h7,9H,3-6,13-14H2,1-2H3,(H2,15,18)(H,17,19);3H2,1-2H3/b8-7-,16-10-; |
| InChIKey | TXRMJIANSBYMTI-QQOZWGATSA-N |
| XLogP | 0.44 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|