C15H19N3O3Y-2 — CID 155787459
N-(2,6-dioxopiperidin-3-yl)-4H-pyridin-4-ide-2-carboxamide;2-methylpropane;yttrium (PubChem CID 155787459) has the molecular formula C15H19N3O3Y-2 and a molecular weight of 378.24 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-4H-pyridin-4-ide-2-carboxamide;2-methylpropane;yttrium.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-4H-pyridin-4-ide-2-carboxamide;2-methylpropane;yttrium |
|---|---|
| PubChem CID | 155787459 |
| Molecular Formula | C15H19N3O3Y-2 |
| Molecular Weight | 378.24 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-4H-pyridin-4-ide-2-carboxamide;2-methylpropane;yttrium |
| SMILES | C[C-](C)C.O=C1CCC(NC(=O)c2c[c-]ccn2)C(=O)N1.[Y] |
| InChI | InChI=1S/C11H10N3O3.C4H9.Y/c15-9-5-4-8(11(17)14-9)13-10(16)7-3-1-2-6-12-7;1-4(2)3;/h2-3,6,8H,4-5H2,(H,13,16)(H,14,15,17);1-3H3;/q2*-1; |
| InChIKey | ILZIXWYTOGSWFB-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|