C11H16N2O2 — CID 167469906
3-[[(3E)-hexa-3,5-dien-3-yl]amino]piperidine-2,6-dione (PubChem CID 167469906) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 3-[[(3E)-hexa-3,5-dien-3-yl]amino]piperidine-2,6-dione.
| Compound Name | 3-[[(3E)-hexa-3,5-dien-3-yl]amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167469906 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 3-[[(3E)-hexa-3,5-dien-3-yl]amino]piperidine-2,6-dione |
| SMILES | C=C/C=C(\CC)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C11H16N2O2/c1-3-5-8(4-2)12-9-6-7-10(14)13-11(9)15/h3,5,9,12H,1,4,6-7H2,2H3,(H,13,14,15)/b8-5+ |
| InChIKey | NMUFWILAFBRVPE-VMPITWQZSA-N |
| XLogP | 0.86 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|