About 5-methyl-3-(1H-1,2,4-triazol-5-yl)-1,2,4-thiadiazole
5-methyl-3-(1H-1,2,4-triazol-5-yl)-1,2,4-thiadiazole (PubChem CID 142391657) has the molecular formula C5H5N5S
and a molecular weight of 167.20 g/mol. Its IUPAC name is 5-methyl-3-(1H-1,2,4-triazol-5-yl)-1,2,4-thiadiazole.
Analyze 5-methyl-3-(1H-1,2,4-triazol-5-yl)-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-(1H-1,2,4-triazol-5-yl)-1,2,4-thiadiazole?
The IUPAC name of 5-methyl-3-(1H-1,2,4-triazol-5-yl)-1,2,4-thiadiazole (CID 142391657) is 5-methyl-3-(1H-1,2,4-triazol-5-yl)-1,2,4-thiadiazole.
What is the SMILES notation for 5-methyl-3-(1H-1,2,4-triazol-5-yl)-1,2,4-thiadiazole?
The canonical SMILES for 5-methyl-3-(1H-1,2,4-triazol-5-yl)-1,2,4-thiadiazole is Cc1nc(-c2ncn[nH]2)ns1.
What is the InChIKey of 5-methyl-3-(1H-1,2,4-triazol-5-yl)-1,2,4-thiadiazole?
The InChIKey is WUXKDNHSEVPJIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N5S/c1-3-8-5(10-11-3)4-6-2-7-9-4/h2H,1H3,(H,6,7,9).
What are the key properties of 5-methyl-3-(1H-1,2,4-triazol-5-yl)-1,2,4-thiadiazole?
5-methyl-3-(1H-1,2,4-triazol-5-yl)-1,2,4-thiadiazole has a molecular weight of 167.20 g/mol, XLogP of 0.63, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-(1H-1,2,4-triazol-5-yl)-1,2,4-thiadiazole is sourced from PubChem (CID 142391657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).