C9H14N2 — CID 142392848
N-methyl-N-[(3Z)-4-methylhexa-1,3,5-trien-2-yl]methanimidamide (PubChem CID 142392848) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is N-methyl-N-[(3Z)-4-methylhexa-1,3,5-trien-2-yl]methanimidamide.
| Compound Name | N-methyl-N-[(3Z)-4-methylhexa-1,3,5-trien-2-yl]methanimidamide |
|---|---|
| PubChem CID | 142392848 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | N-methyl-N-[(3Z)-4-methylhexa-1,3,5-trien-2-yl]methanimidamide |
| SMILES | [H]/N=C/N(C)C(=C)/C=C(/C)C=C |
| InChI | InChI=1S/C9H14N2/c1-5-8(2)6-9(3)11(4)7-10/h5-7,10H,1,3H2,2,4H3/b8-6-,10-7+ |
| InChIKey | QKMSZHADYMIZSF-GOOBONSCSA-N |
| XLogP | 2.17 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|