C8H15N3 — CID 143160360
N-[(1E,3Z)-1-aminohexa-1,3-dien-2-yl]-N-methylmethanimidamide (PubChem CID 143160360) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is N-[(1E,3Z)-1-aminohexa-1,3-dien-2-yl]-N-methylmethanimidamide.
| Compound Name | N-[(1E,3Z)-1-aminohexa-1,3-dien-2-yl]-N-methylmethanimidamide |
|---|---|
| PubChem CID | 143160360 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | N-[(1E,3Z)-1-aminohexa-1,3-dien-2-yl]-N-methylmethanimidamide |
| SMILES | [H]/N=C/N(C)C(/C=C\CC)=C/N |
| InChI | InChI=1S/C8H15N3/c1-3-4-5-8(6-9)11(2)7-10/h4-7,10H,3,9H2,1-2H3/b5-4-,8-6+,10-7+ |
| InChIKey | AAXNDEOXIZCNKE-KRMUTCCGSA-N |
| XLogP | 1.29 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|