C16H12ClF5N2OS — CID 142393237
4-chloro-2,5-difluoroaniline;6-(2,2,2-trifluoroethoxy)-1H-indole-3-thiol (PubChem CID 142393237) has the molecular formula C16H12ClF5N2OS and a molecular weight of 410.80 g/mol. Its IUPAC name is 4-chloro-2,5-difluoroaniline;6-(2,2,2-trifluoroethoxy)-1H-indole-3-thiol.
| Compound Name | 4-chloro-2,5-difluoroaniline;6-(2,2,2-trifluoroethoxy)-1H-indole-3-thiol |
|---|---|
| PubChem CID | 142393237 |
| Molecular Formula | C16H12ClF5N2OS |
| Molecular Weight | 410.80 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 4-chloro-2,5-difluoroaniline;6-(2,2,2-trifluoroethoxy)-1H-indole-3-thiol |
| SMILES | FC(F)(F)COc1ccc2c(S)c[nH]c2c1.Nc1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C10H8F3NOS.C6H4ClF2N/c11-10(12,13)5-15-6-1-2-7-8(3-6)14-4-9(7)16;7-3-1-5(9)6(10)2-4(3)8/h1-4,14,16H,5H2;1-2H,10H2 |
| InChIKey | WGCRFWWNPVQQCF-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.80 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|