C19H34FNO — CID 142399914
ethane;4-[[(2E,4E,6E)-4-fluoro-8-methylnona-2,4,6-trien-3-yl]oxymethyl]-1-methylpiperidine (PubChem CID 142399914) has the molecular formula C19H34FNO and a molecular weight of 311.49 g/mol. Its IUPAC name is ethane;4-[[(2E,4E,6E)-4-fluoro-8-methylnona-2,4,6-trien-3-yl]oxymethyl]-1-methylpiperidine.
| Compound Name | ethane;4-[[(2E,4E,6E)-4-fluoro-8-methylnona-2,4,6-trien-3-yl]oxymethyl]-1-methylpiperidine |
|---|---|
| PubChem CID | 142399914 |
| Molecular Formula | C19H34FNO |
| Molecular Weight | 311.49 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | ethane;4-[[(2E,4E,6E)-4-fluoro-8-methylnona-2,4,6-trien-3-yl]oxymethyl]-1-methylpiperidine |
| SMILES | C/C=C(OCC1CCN(C)CC1)\C(F)=C/C=C/C(C)C.CC |
| InChI | InChI=1S/C17H28FNO.C2H6/c1-5-17(16(18)8-6-7-14(2)3)20-13-15-9-11-19(4)12-10-15;1-2/h5-8,14-15H,9-13H2,1-4H3;1-2H3/b7-6+,16-8+,17-5+; |
| InChIKey | WJECOQRYDJILBB-DNYQZCESSA-N |
| XLogP | 5.34 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.49 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|