C13H26N2O2S2 — CID 142404366
N-[2-[2-(ethylamino)ethyldisulfanyl]ethyl]-4-oxoheptanamide (PubChem CID 142404366) has the molecular formula C13H26N2O2S2 and a molecular weight of 306.50 g/mol. Its IUPAC name is N-[2-[2-(ethylamino)ethyldisulfanyl]ethyl]-4-oxoheptanamide.
| Compound Name | N-[2-[2-(ethylamino)ethyldisulfanyl]ethyl]-4-oxoheptanamide |
|---|---|
| PubChem CID | 142404366 |
| Molecular Formula | C13H26N2O2S2 |
| Molecular Weight | 306.50 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | N-[2-[2-(ethylamino)ethyldisulfanyl]ethyl]-4-oxoheptanamide |
| SMILES | CCCC(=O)CCC(=O)NCCSSCCNCC |
| InChI | InChI=1S/C13H26N2O2S2/c1-3-5-12(16)6-7-13(17)15-9-11-19-18-10-8-14-4-2/h14H,3-11H2,1-2H3,(H,15,17) |
| InChIKey | OZTXSZKWPFRZAD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|