About N-ethyl-3-methylbutanamide;4-methylmorpholine;molecular hydrogen
N-ethyl-3-methylbutanamide;4-methylmorpholine;molecular hydrogen (PubChem CID 142406599) has the molecular formula C12H28N2O2
and a molecular weight of 232.37 g/mol. Its IUPAC name is N-ethyl-3-methylbutanamide;4-methylmorpholine;molecular hydrogen.
Molecular Properties
| Compound Name | N-ethyl-3-methylbutanamide;4-methylmorpholine;molecular hydrogen |
| PubChem CID | 142406599 |
| Molecular Formula | C12H28N2O2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | N-ethyl-3-methylbutanamide;4-methylmorpholine;molecular hydrogen |
| SMILES | CCNC(=O)CC(C)C.CN1CCOCC1.[H][H] |
| InChI | InChI=1S/C7H15NO.C5H11NO.H2/c1-4-8-7(9)5-6(2)3;1-6-2-4-7-5-3-6;/h6H,4-5H2,1-3H3,(H,8,9);2-5H2,1H3;1H |
| InChIKey | RAGQSKMFOALOOW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-3-methylbutanamide;4-methylmorpholine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3-methylbutanamide;4-methylmorpholine;molecular hydrogen?
The IUPAC name of N-ethyl-3-methylbutanamide;4-methylmorpholine;molecular hydrogen (CID 142406599) is N-ethyl-3-methylbutanamide;4-methylmorpholine;molecular hydrogen.
What is the SMILES notation for N-ethyl-3-methylbutanamide;4-methylmorpholine;molecular hydrogen?
The canonical SMILES for N-ethyl-3-methylbutanamide;4-methylmorpholine;molecular hydrogen is CCNC(=O)CC(C)C.CN1CCOCC1.[H][H].
What is the InChIKey of N-ethyl-3-methylbutanamide;4-methylmorpholine;molecular hydrogen?
The InChIKey is RAGQSKMFOALOOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO.C5H11NO.H2/c1-4-8-7(9)5-6(2)3;1-6-2-4-7-5-3-6;/h6H,4-5H2,1-3H3,(H,8,9);2-5H2,1H3;1H.
What are the key properties of N-ethyl-3-methylbutanamide;4-methylmorpholine;molecular hydrogen?
N-ethyl-3-methylbutanamide;4-methylmorpholine;molecular hydrogen has a molecular weight of 232.37 g/mol, XLogP of 1.36, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3-methylbutanamide;4-methylmorpholine;molecular hydrogen is sourced from PubChem (CID 142406599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).