C11H18O3 — CID 14241030
methyl (2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoate (PubChem CID 14241030) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is methyl (2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoate.
| Compound Name | methyl (2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoate |
|---|---|
| PubChem CID | 14241030 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | methyl (2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoate |
| SMILES | C=CC(C)(O)CC/C=C(\C)C(=O)OC |
| InChI | InChI=1S/C11H18O3/c1-5-11(3,13)8-6-7-9(2)10(12)14-4/h5,7,13H,1,6,8H2,2-4H3/b9-7+ |
| InChIKey | NWDBBLFNNILKKJ-VQHVLOKHSA-N |
| XLogP | 1.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|