C18H30O3 — CID 162873107
[(4S,6E,10S)-10-hydroxy-2,6,10-trimethyldodeca-2,6,11-trien-4-yl] propanoate (PubChem CID 162873107) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is [(4S,6E,10S)-10-hydroxy-2,6,10-trimethyldodeca-2,6,11-trien-4-yl] propanoate.
| Compound Name | [(4S,6E,10S)-10-hydroxy-2,6,10-trimethyldodeca-2,6,11-trien-4-yl] propanoate |
|---|---|
| PubChem CID | 162873107 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | [(4S,6E,10S)-10-hydroxy-2,6,10-trimethyldodeca-2,6,11-trien-4-yl] propanoate |
| SMILES | C=C[C@@](C)(O)CC/C=C(\C)C[C@@H](C=C(C)C)OC(=O)CC |
| InChI | InChI=1S/C18H30O3/c1-7-17(19)21-16(12-14(3)4)13-15(5)10-9-11-18(6,20)8-2/h8,10,12,16,20H,2,7,9,11,13H2,1,3-6H3/b15-10+/t16-,18-/m1/s1 |
| InChIKey | WYWLOZXPFDNZML-XPQPCJHHSA-N |
| XLogP | 4.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|