C44H71N7O6S2 — CID 142413432
4-[[bis[7-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]octyl]amino]methyl]benzoic acid (PubChem CID 142413432) has the molecular formula C44H71N7O6S2 and a molecular weight of 858.23 g/mol. Its IUPAC name is 4-[[bis[7-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]octyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[bis[7-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]octyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 142413432 |
| Molecular Formula | C44H71N7O6S2 |
| Molecular Weight | 858.23 g/mol |
| Exact Mass | 857.49 |
| IUPAC Name | 4-[[bis[7-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]octyl]amino]methyl]benzoic acid |
| SMILES | CC(CCCCCCN(CCCCCCC(C)NC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21)Cc1ccc(C(=O)O)cc1)NC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21 |
| InChI | InChI=1S/C44H71N7O6S2/c1-30(45-38(52)19-11-9-17-36-40-34(28-58-36)47-43(56)49-40)15-7-3-5-13-25-51(27-32-21-23-33(24-22-32)42(54)55)26-14-6-4-8-16-31(2)46-39(53)20-12-10-18-37-41-35(29-59-37)48-44(57)50-41/h21-24,30-31,34-37,40-41H,3-20,25-29H2,1-2H3,(H,45,52)(H,46,53)(H,54,55)(H2,47,49,56)(H2,48,50,57)/t30?,31?,34-,35-,36-,37-,40-,41-/m0/s1 |
| InChIKey | OJFGBVOPWRSBFZ-AWSNWHSUSA-N |
| XLogP | 6.55 |
| TPSA | 181.00 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.23 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|