C18H15ClF3NO3 — CID 142415214
ethyl 6-[2-chloro-4-[1-(trifluoromethyl)cyclopropyl]phenoxy]pyridine-3-carboxylate (PubChem CID 142415214) has the molecular formula C18H15ClF3NO3 and a molecular weight of 385.77 g/mol. Its IUPAC name is ethyl 6-[2-chloro-4-[1-(trifluoromethyl)cyclopropyl]phenoxy]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[2-chloro-4-[1-(trifluoromethyl)cyclopropyl]phenoxy]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 142415214 |
| Molecular Formula | C18H15ClF3NO3 |
| Molecular Weight | 385.77 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | ethyl 6-[2-chloro-4-[1-(trifluoromethyl)cyclopropyl]phenoxy]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(Oc2ccc(C3(C(F)(F)F)CC3)cc2Cl)nc1 |
| InChI | InChI=1S/C18H15ClF3NO3/c1-2-25-16(24)11-3-6-15(23-10-11)26-14-5-4-12(9-13(14)19)17(7-8-17)18(20,21)22/h3-6,9-10H,2,7-8H2,1H3 |
| InChIKey | DHHVQGMDVCAJNZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.77 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |