About 1-[6-[4-[1-(1,1-difluoroethyl)cyclopropyl]-2-methylphenoxy]-3-pyridinyl]ethanone
1-[6-[4-[1-(1,1-difluoroethyl)cyclopropyl]-2-methylphenoxy]-3-pyridinyl]ethanone (PubChem CID 158968389) has the molecular formula C19H19F2NO2
and a molecular weight of 331.36 g/mol. Its IUPAC name is 1-[6-[4-[1-(1,1-difluoroethyl)cyclopropyl]-2-methylphenoxy]-3-pyridinyl]ethanone.
Molecular Properties
| Compound Name | 1-[6-[4-[1-(1,1-difluoroethyl)cyclopropyl]-2-methylphenoxy]-3-pyridinyl]ethanone |
| PubChem CID | 158968389 |
| Molecular Formula | C19H19F2NO2 |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 1-[6-[4-[1-(1,1-difluoroethyl)cyclopropyl]-2-methylphenoxy]-3-pyridinyl]ethanone |
| SMILES | CC(=O)c1ccc(Oc2ccc(C3(C(C)(F)F)CC3)cc2C)nc1 |
| InChI | InChI=1S/C19H19F2NO2/c1-12-10-15(19(8-9-19)18(3,20)21)5-6-16(12)24-17-7-4-14(11-22-17)13(2)23/h4-7,10-11H,8-9H2,1-3H3 |
| InChIKey | JNMPJQMWXRXQTA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[6-[4-[1-(1,1-difluoroethyl)cyclopropyl]-2-methylphenoxy]-3-pyridinyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-[4-[1-(1,1-difluoroethyl)cyclopropyl]-2-methylphenoxy]-3-pyridinyl]ethanone?
The IUPAC name of 1-[6-[4-[1-(1,1-difluoroethyl)cyclopropyl]-2-methylphenoxy]-3-pyridinyl]ethanone (CID 158968389) is 1-[6-[4-[1-(1,1-difluoroethyl)cyclopropyl]-2-methylphenoxy]-3-pyridinyl]ethanone.
What is the SMILES notation for 1-[6-[4-[1-(1,1-difluoroethyl)cyclopropyl]-2-methylphenoxy]-3-pyridinyl]ethanone?
The canonical SMILES for 1-[6-[4-[1-(1,1-difluoroethyl)cyclopropyl]-2-methylphenoxy]-3-pyridinyl]ethanone is CC(=O)c1ccc(Oc2ccc(C3(C(C)(F)F)CC3)cc2C)nc1.
What is the InChIKey of 1-[6-[4-[1-(1,1-difluoroethyl)cyclopropyl]-2-methylphenoxy]-3-pyridinyl]ethanone?
The InChIKey is JNMPJQMWXRXQTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19F2NO2/c1-12-10-15(19(8-9-19)18(3,20)21)5-6-16(12)24-17-7-4-14(11-22-17)13(2)23/h4-7,10-11H,8-9H2,1-3H3.
What are the key properties of 1-[6-[4-[1-(1,1-difluoroethyl)cyclopropyl]-2-methylphenoxy]-3-pyridinyl]ethanone?
1-[6-[4-[1-(1,1-difluoroethyl)cyclopropyl]-2-methylphenoxy]-3-pyridinyl]ethanone has a molecular weight of 331.36 g/mol, XLogP of 5.07, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-[4-[1-(1,1-difluoroethyl)cyclopropyl]-2-methylphenoxy]-3-pyridinyl]ethanone is sourced from PubChem (CID 158968389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).