C17H27NO3 — CID 142416930
tert-butyl (5E)-2-formyl-4-methylidene-5-prop-2-enylidenepiperidine-1-carboxylate;ethane (PubChem CID 142416930) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is tert-butyl (5E)-2-formyl-4-methylidene-5-prop-2-enylidenepiperidine-1-carboxylate;ethane.
| Compound Name | tert-butyl (5E)-2-formyl-4-methylidene-5-prop-2-enylidenepiperidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 142416930 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | tert-butyl (5E)-2-formyl-4-methylidene-5-prop-2-enylidenepiperidine-1-carboxylate;ethane |
| SMILES | C=C/C=C1/CN(C(=O)OC(C)(C)C)C(C=O)CC1=C.CC |
| InChI | InChI=1S/C15H21NO3.C2H6/c1-6-7-12-9-16(13(10-17)8-11(12)2)14(18)19-15(3,4)5;1-2/h6-7,10,13H,1-2,8-9H2,3-5H3;1-2H3/b12-7-; |
| InChIKey | AHQAVPVOHLBHCR-OZLKFZLXSA-N |
| XLogP | 3.89 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|