C30H38FN5O3S — CID 142418642
N-cyclohexyl-1-[3-fluoro-4-[4-[methyl-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]thieno[3,2-d]pyrimidin-7-yl]phenyl]methanimine oxide (PubChem CID 142418642) has the molecular formula C30H38FN5O3S and a molecular weight of 567.73 g/mol. Its IUPAC name is N-cyclohexyl-1-[3-fluoro-4-[4-[methyl-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]thieno[3,2-d]pyrimidin-7-yl]phenyl]methanimine oxide.
| Compound Name | N-cyclohexyl-1-[3-fluoro-4-[4-[methyl-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]thieno[3,2-d]pyrimidin-7-yl]phenyl]methanimine oxide |
|---|---|
| PubChem CID | 142418642 |
| Molecular Formula | C30H38FN5O3S |
| Molecular Weight | 567.73 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | N-cyclohexyl-1-[3-fluoro-4-[4-[methyl-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]thieno[3,2-d]pyrimidin-7-yl]phenyl]methanimine oxide |
| SMILES | CN(c1ncnc2c(-c3ccc(/C=[N+](\[O-])C4CCCCC4)cc3F)csc12)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C30H38FN5O3S/c1-30(2,3)39-29(37)35-14-12-21(13-15-35)34(4)28-27-26(32-19-33-28)24(18-40-27)23-11-10-20(16-25(23)31)17-36(38)22-8-6-5-7-9-22/h10-11,16-19,21-22H,5-9,12-15H2,1-4H3/b36-17- |
| InChIKey | YNDSKSNOUGKYJI-RODHXAHZSA-N |
| XLogP | 6.59 |
| TPSA | 84.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.73 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|