C28H36F3N3O3 — CID 142418654
1-[4-[3,5-difluoro-4-[methyl-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methyl]amino]phenyl]-3-fluorophenyl]-N-propan-2-ylmethanimine oxide (PubChem CID 142418654) has the molecular formula C28H36F3N3O3 and a molecular weight of 519.61 g/mol. Its IUPAC name is 1-[4-[3,5-difluoro-4-[methyl-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methyl]amino]phenyl]-3-fluorophenyl]-N-propan-2-ylmethanimine oxide.
| Compound Name | 1-[4-[3,5-difluoro-4-[methyl-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methyl]amino]phenyl]-3-fluorophenyl]-N-propan-2-ylmethanimine oxide |
|---|---|
| PubChem CID | 142418654 |
| Molecular Formula | C28H36F3N3O3 |
| Molecular Weight | 519.61 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | 1-[4-[3,5-difluoro-4-[methyl-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methyl]amino]phenyl]-3-fluorophenyl]-N-propan-2-ylmethanimine oxide |
| SMILES | CC(C)/[N+]([O-])=C/c1ccc(-c2cc(F)c(N(C)CC3CCN(C(=O)OC(C)(C)C)CC3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C28H36F3N3O3/c1-18(2)34(36)17-20-7-8-22(23(29)13-20)21-14-24(30)26(25(31)15-21)32(6)16-19-9-11-33(12-10-19)27(35)37-28(3,4)5/h7-8,13-15,17-19H,9-12,16H2,1-6H3/b34-17- |
| InChIKey | QVZXHWBNARGUHJ-DLCNMLRHSA-N |
| XLogP | 6.19 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.61 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|