C30H45N5O6 — CID 142419207
(Z)-2-[4-methoxy-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propylcarbamoyl]piperidin-4-yl]-6,9-dioxo-9-(propylamino)non-2-enoic acid (PubChem CID 142419207) has the molecular formula C30H45N5O6 and a molecular weight of 571.72 g/mol. Its IUPAC name is (Z)-2-[4-methoxy-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propylcarbamoyl]piperidin-4-yl]-6,9-dioxo-9-(propylamino)non-2-enoic acid.
| Compound Name | (Z)-2-[4-methoxy-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propylcarbamoyl]piperidin-4-yl]-6,9-dioxo-9-(propylamino)non-2-enoic acid |
|---|---|
| PubChem CID | 142419207 |
| Molecular Formula | C30H45N5O6 |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.34 |
| IUPAC Name | (Z)-2-[4-methoxy-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propylcarbamoyl]piperidin-4-yl]-6,9-dioxo-9-(propylamino)non-2-enoic acid |
| SMILES | CCCNC(=O)CCC(=O)CC/C=C(\C(=O)O)C1(OC)CCN(C(=O)NCCCc2ccc3c(n2)NCCC3)CC1 |
| InChI | InChI=1S/C30H45N5O6/c1-3-17-31-26(37)14-13-24(36)9-4-10-25(28(38)39)30(41-2)15-20-35(21-16-30)29(40)33-19-6-8-23-12-11-22-7-5-18-32-27(22)34-23/h10-12H,3-9,13-21H2,1-2H3,(H,31,37)(H,32,34)(H,33,40)(H,38,39)/b25-10+ |
| InChIKey | RAMSOPIWIBNBBD-KIBLKLHPSA-N |
| XLogP | 3.23 |
| TPSA | 149.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|