C16H12F3N3OS2 — CID 142420165
2-methyl-1-methylidene-5-thiophen-2-yl-N-(3,4,5-trifluorophenyl)-1,2,6-thiadiazine-3-carboxamide (PubChem CID 142420165) has the molecular formula C16H12F3N3OS2 and a molecular weight of 383.42 g/mol. Its IUPAC name is 2-methyl-1-methylidene-5-thiophen-2-yl-N-(3,4,5-trifluorophenyl)-1,2,6-thiadiazine-3-carboxamide.
| Compound Name | 2-methyl-1-methylidene-5-thiophen-2-yl-N-(3,4,5-trifluorophenyl)-1,2,6-thiadiazine-3-carboxamide |
|---|---|
| PubChem CID | 142420165 |
| Molecular Formula | C16H12F3N3OS2 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 2-methyl-1-methylidene-5-thiophen-2-yl-N-(3,4,5-trifluorophenyl)-1,2,6-thiadiazine-3-carboxamide |
| SMILES | C=S1N=C(c2cccs2)C=C(C(=O)Nc2cc(F)c(F)c(F)c2)N1C |
| InChI | InChI=1S/C16H12F3N3OS2/c1-22-13(8-12(21-25(22)2)14-4-3-5-24-14)16(23)20-9-6-10(17)15(19)11(18)7-9/h3-8H,2H2,1H3,(H,20,23) |
| InChIKey | UZYGIXCQQDZOJR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|