C15H9BrF3N3O3S2 — CID 166808339
5-(5-bromothiophen-2-yl)-2-methyl-1,1-dioxo-N-(3,4,5-trifluorophenyl)-1,2,6-thiadiazine-3-carboxamide (PubChem CID 166808339) has the molecular formula C15H9BrF3N3O3S2 and a molecular weight of 480.29 g/mol. Its IUPAC name is 5-(5-bromothiophen-2-yl)-2-methyl-1,1-dioxo-N-(3,4,5-trifluorophenyl)-1,2,6-thiadiazine-3-carboxamide.
| Compound Name | 5-(5-bromothiophen-2-yl)-2-methyl-1,1-dioxo-N-(3,4,5-trifluorophenyl)-1,2,6-thiadiazine-3-carboxamide |
|---|---|
| PubChem CID | 166808339 |
| Molecular Formula | C15H9BrF3N3O3S2 |
| Molecular Weight | 480.29 g/mol |
| Exact Mass | 478.92 |
| IUPAC Name | 5-(5-bromothiophen-2-yl)-2-methyl-1,1-dioxo-N-(3,4,5-trifluorophenyl)-1,2,6-thiadiazine-3-carboxamide |
| SMILES | CN1C(C(=O)Nc2cc(F)c(F)c(F)c2)=CC(c2ccc(Br)s2)=NS1(=O)=O |
| InChI | InChI=1S/C15H9BrF3N3O3S2/c1-22-11(15(23)20-7-4-8(17)14(19)9(18)5-7)6-10(21-27(22,24)25)12-2-3-13(16)26-12/h2-6H,1H3,(H,20,23) |
| InChIKey | AKEKBWZBWXAXLC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.29 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|