C12H14F2 — CID 142421579
1-[(3Z)-3,4-difluorohexa-1,3,5-trien-2-yl]-3-methylcyclopentene (PubChem CID 142421579) has the molecular formula C12H14F2 and a molecular weight of 196.24 g/mol. Its IUPAC name is 1-[(3Z)-3,4-difluorohexa-1,3,5-trien-2-yl]-3-methylcyclopentene.
| Compound Name | 1-[(3Z)-3,4-difluorohexa-1,3,5-trien-2-yl]-3-methylcyclopentene |
|---|---|
| PubChem CID | 142421579 |
| Molecular Formula | C12H14F2 |
| Molecular Weight | 196.24 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 1-[(3Z)-3,4-difluorohexa-1,3,5-trien-2-yl]-3-methylcyclopentene |
| SMILES | C=C/C(F)=C(/F)C(=C)C1=CC(C)CC1 |
| InChI | InChI=1S/C12H14F2/c1-4-11(13)12(14)9(3)10-6-5-8(2)7-10/h4,7-8H,1,3,5-6H2,2H3/b12-11- |
| InChIKey | BAVFSRMLOYMUBM-QXMHVHEDSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.24 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|