C11H16N4S — CID 142424158
5-(anilinomethyl)-1,2-dihydro-1,2,4-triazole-3-thione;ethane (PubChem CID 142424158) has the molecular formula C11H16N4S and a molecular weight of 236.34 g/mol. Its IUPAC name is 5-(anilinomethyl)-1,2-dihydro-1,2,4-triazole-3-thione;ethane.
| Compound Name | 5-(anilinomethyl)-1,2-dihydro-1,2,4-triazole-3-thione;ethane |
|---|---|
| PubChem CID | 142424158 |
| Molecular Formula | C11H16N4S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 5-(anilinomethyl)-1,2-dihydro-1,2,4-triazole-3-thione;ethane |
| SMILES | CC.S=c1nc(CNc2ccccc2)[nH][nH]1 |
| InChI | InChI=1S/C9H10N4S.C2H6/c14-9-11-8(12-13-9)6-10-7-4-2-1-3-5-7;1-2/h1-5,10H,6H2,(H2,11,12,13,14);1-2H3 |
| InChIKey | ULFRDWRJAGVJPX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 56.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|